C21H18Cl2N4O3 — CID 135269342
8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-propyl-3H-purine-2,6-dione (PubChem CID 135269342) has the molecular formula C21H18Cl2N4O3 and a molecular weight of 445.31 g/mol. Its IUPAC name is 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-propyl-3H-purine-2,6-dione.
| Compound Name | 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-propyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 135269342 |
| Molecular Formula | C21H18Cl2N4O3 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-propyl-3H-purine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c2nc(Oc3cccc(Cl)c3)n(Cc3ccc(Cl)cc3)c2c1=O |
| InChI | InChI=1S/C21H18Cl2N4O3/c1-2-10-26-19(28)17-18(24-20(26)29)25-21(30-16-5-3-4-15(23)11-16)27(17)12-13-6-8-14(22)9-7-13/h3-9,11H,2,10,12H2,1H3,(H,24,29) |
| InChIKey | ANHJYEJVCIQCNW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |