C26H26Cl2N2O — CID 137474551
2-(3-chlorophenoxy)-1-[(4-chlorophenyl)methyl]-7-methyl-6-(3-methylbutyl)benzimidazole (PubChem CID 137474551) has the molecular formula C26H26Cl2N2O and a molecular weight of 453.41 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1-[(4-chlorophenyl)methyl]-7-methyl-6-(3-methylbutyl)benzimidazole.
| Compound Name | 2-(3-chlorophenoxy)-1-[(4-chlorophenyl)methyl]-7-methyl-6-(3-methylbutyl)benzimidazole |
|---|---|
| PubChem CID | 137474551 |
| Molecular Formula | C26H26Cl2N2O |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-(3-chlorophenoxy)-1-[(4-chlorophenyl)methyl]-7-methyl-6-(3-methylbutyl)benzimidazole |
| SMILES | Cc1c(CCC(C)C)ccc2nc(Oc3cccc(Cl)c3)n(Cc3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C26H26Cl2N2O/c1-17(2)7-10-20-11-14-24-25(18(20)3)30(16-19-8-12-21(27)13-9-19)26(29-24)31-23-6-4-5-22(28)15-23/h4-6,8-9,11-15,17H,7,10,16H2,1-3H3 |
| InChIKey | GVXWLWYHVXTJDO-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |