C22H19N5O4 — CID 163887602
3-[[7-benzyl-1-(3-hydroxypropyl)-2,6-dioxo-3H-purin-8-yl]oxy]benzonitrile (PubChem CID 163887602) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is 3-[[7-benzyl-1-(3-hydroxypropyl)-2,6-dioxo-3H-purin-8-yl]oxy]benzonitrile.
| Compound Name | 3-[[7-benzyl-1-(3-hydroxypropyl)-2,6-dioxo-3H-purin-8-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 163887602 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3-[[7-benzyl-1-(3-hydroxypropyl)-2,6-dioxo-3H-purin-8-yl]oxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2nc3[nH]c(=O)n(CCCO)c(=O)c3n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H19N5O4/c23-13-16-8-4-9-17(12-16)31-22-25-19-18(27(22)14-15-6-2-1-3-7-15)20(29)26(10-5-11-28)21(30)24-19/h1-4,6-9,12,28H,5,10-11,14H2,(H,24,30) |
| InChIKey | PYTOXAXNKDXUAQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |