C29H31ClN4O7 — CID 90402759
3-[2-[7-[(4-chlorophenyl)methyl]-3-methyl-1-[2-(oxan-2-yloxy)ethyl]-2,6-dioxopurin-8-yl]oxyethoxy]benzaldehyde (PubChem CID 90402759) has the molecular formula C29H31ClN4O7 and a molecular weight of 583.04 g/mol. Its IUPAC name is 3-[2-[7-[(4-chlorophenyl)methyl]-3-methyl-1-[2-(oxan-2-yloxy)ethyl]-2,6-dioxopurin-8-yl]oxyethoxy]benzaldehyde.
| Compound Name | 3-[2-[7-[(4-chlorophenyl)methyl]-3-methyl-1-[2-(oxan-2-yloxy)ethyl]-2,6-dioxopurin-8-yl]oxyethoxy]benzaldehyde |
|---|---|
| PubChem CID | 90402759 |
| Molecular Formula | C29H31ClN4O7 |
| Molecular Weight | 583.04 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 3-[2-[7-[(4-chlorophenyl)methyl]-3-methyl-1-[2-(oxan-2-yloxy)ethyl]-2,6-dioxopurin-8-yl]oxyethoxy]benzaldehyde |
| SMILES | Cn1c(=O)n(CCOC2CCCCO2)c(=O)c2c1nc(OCCOc1cccc(C=O)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H31ClN4O7/c1-32-26-25(27(36)33(29(32)37)12-14-40-24-7-2-3-13-39-24)34(18-20-8-10-22(30)11-9-20)28(31-26)41-16-15-38-23-6-4-5-21(17-23)19-35/h4-6,8-11,17,19,24H,2-3,7,12-16,18H2,1H3 |
| InChIKey | DNSILHNTEMKCOB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 115.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.04 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|