C24H34ClN5O6S — CID 90425847
N-[7-[(4-chlorophenyl)methyl]-3-methyl-9-[3-(oxan-2-yloxy)propyl]-2,6-dioxo-8H-purin-8-yl]propane-2-sulfonamide (PubChem CID 90425847) has the molecular formula C24H34ClN5O6S and a molecular weight of 556.09 g/mol. Its IUPAC name is N-[7-[(4-chlorophenyl)methyl]-3-methyl-9-[3-(oxan-2-yloxy)propyl]-2,6-dioxo-8H-purin-8-yl]propane-2-sulfonamide.
| Compound Name | N-[7-[(4-chlorophenyl)methyl]-3-methyl-9-[3-(oxan-2-yloxy)propyl]-2,6-dioxo-8H-purin-8-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 90425847 |
| Molecular Formula | C24H34ClN5O6S |
| Molecular Weight | 556.09 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | N-[7-[(4-chlorophenyl)methyl]-3-methyl-9-[3-(oxan-2-yloxy)propyl]-2,6-dioxo-8H-purin-8-yl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1N(Cc2ccc(Cl)cc2)c2c(n(C)c(=O)[nH]c2=O)N1CCCOC1CCCCO1 |
| InChI | InChI=1S/C24H34ClN5O6S/c1-16(2)37(33,34)27-23-29(12-6-14-36-19-7-4-5-13-35-19)22-20(21(31)26-24(32)28(22)3)30(23)15-17-8-10-18(25)11-9-17/h8-11,16,19,23,27H,4-7,12-15H2,1-3H3,(H,26,31,32) |
| InChIKey | OFEJSQDTNDVXAF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.09 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|