C24H33BrN4O4 — CID 154938002
7-benzyl-8-bromo-3-butan-2-yl-1-[3-(oxan-2-yloxy)propyl]-8,9-dihydropurine-2,6-dione (PubChem CID 154938002) has the molecular formula C24H33BrN4O4 and a molecular weight of 521.46 g/mol. Its IUPAC name is 7-benzyl-8-bromo-3-butan-2-yl-1-[3-(oxan-2-yloxy)propyl]-8,9-dihydropurine-2,6-dione.
| Compound Name | 7-benzyl-8-bromo-3-butan-2-yl-1-[3-(oxan-2-yloxy)propyl]-8,9-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 154938002 |
| Molecular Formula | C24H33BrN4O4 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 7-benzyl-8-bromo-3-butan-2-yl-1-[3-(oxan-2-yloxy)propyl]-8,9-dihydropurine-2,6-dione |
| SMILES | CCC(C)n1c2c(c(=O)n(CCCOC3CCCCO3)c1=O)N(Cc1ccccc1)C(Br)N2 |
| InChI | InChI=1S/C24H33BrN4O4/c1-3-17(2)29-21-20(28(23(25)26-21)16-18-10-5-4-6-11-18)22(30)27(24(29)31)13-9-15-33-19-12-7-8-14-32-19/h4-6,10-11,17,19,23,26H,3,7-9,12-16H2,1-2H3 |
| InChIKey | LRNILLCTQRNSBM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|