About ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate
ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate (PubChem CID 90404078) has the molecular formula C17H18N4O4
and a molecular weight of 342.36 g/mol. Its IUPAC name is ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate |
| PubChem CID | 90404078 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1cccc(Cc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C17H18N4O4/c1-4-25-16(23)11-7-5-6-10(8-11)9-12-18-13-14(19-12)20(2)17(24)21(3)15(13)22/h5-8H,4,9H2,1-3H3,(H,18,19) |
| InChIKey | VDRPXIUUZNKXRX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate?
The IUPAC name of ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate (CID 90404078) is ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate.
What is the SMILES notation for ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate?
The canonical SMILES for ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate is CCOC(=O)c1cccc(Cc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)c1.
What is the InChIKey of ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate?
The InChIKey is VDRPXIUUZNKXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O4/c1-4-25-16(23)11-7-5-6-10(8-11)9-12-18-13-14(19-12)20(2)17(24)21(3)15(13)22/h5-8H,4,9H2,1-3H3,(H,18,19).
What are the key properties of ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate?
ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate has a molecular weight of 342.36 g/mol, XLogP of 0.73, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]benzoate is sourced from PubChem (CID 90404078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).