C18H20N4O6S — CID 55385540
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-ethylsulfonylbenzoate (PubChem CID 55385540) has the molecular formula C18H20N4O6S and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-ethylsulfonylbenzoate.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 55385540 |
| Molecular Formula | C18H20N4O6S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)OCCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C18H20N4O6S/c1-4-29(26,27)13-8-6-5-7-12(13)17(24)28-10-9-22-11-19-15-14(22)16(23)21(3)18(25)20(15)2/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | RUFMEVWGOIKSKV-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |