C16H26N4O3 — CID 57299123
1,3-dibutyl-7-(3-hydroxypropyl)purine-2,6-dione (PubChem CID 57299123) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1,3-dibutyl-7-(3-hydroxypropyl)purine-2,6-dione.
| Compound Name | 1,3-dibutyl-7-(3-hydroxypropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 57299123 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1,3-dibutyl-7-(3-hydroxypropyl)purine-2,6-dione |
| SMILES | CCCCn1c(=O)c2c(ncn2CCCO)n(CCCC)c1=O |
| InChI | InChI=1S/C16H26N4O3/c1-3-5-9-19-14-13(18(12-17-14)8-7-11-21)15(22)20(16(19)23)10-6-4-2/h12,21H,3-11H2,1-2H3 |
| InChIKey | GWZLBKIGUHRHBJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |