C23H31N5O3 — CID 29434995
2-(7-butyl-2,6-dioxo-3-propylpurin-1-yl)-N-phenyl-N-propan-2-ylacetamide (PubChem CID 29434995) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-(7-butyl-2,6-dioxo-3-propylpurin-1-yl)-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-(7-butyl-2,6-dioxo-3-propylpurin-1-yl)-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 29434995 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-(7-butyl-2,6-dioxo-3-propylpurin-1-yl)-N-phenyl-N-propan-2-ylacetamide |
| SMILES | CCCCn1cnc2c1c(=O)n(CC(=O)N(c1ccccc1)C(C)C)c(=O)n2CCC |
| InChI | InChI=1S/C23H31N5O3/c1-5-7-14-25-16-24-21-20(25)22(30)27(23(31)26(21)13-6-2)15-19(29)28(17(3)4)18-11-9-8-10-12-18/h8-12,16-17H,5-7,13-15H2,1-4H3 |
| InChIKey | AVVBUFGCFLFJPN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |