C22H28FN5O3 — CID 18290957
2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(5-fluoro-2-methylphenyl)acetamide (PubChem CID 18290957) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(5-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18290957 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
| SMILES | CCCCn1cnc2c1c(=O)n(CC(=O)Nc1cc(F)ccc1C)c(=O)n2CCCC |
| InChI | InChI=1S/C22H28FN5O3/c1-4-6-10-26-14-24-20-19(26)21(30)28(22(31)27(20)11-7-5-2)13-18(29)25-17-12-16(23)9-8-15(17)3/h8-9,12,14H,4-7,10-11,13H2,1-3H3,(H,25,29) |
| InChIKey | PLTQTVZYHCHKEO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |