C23H29N5O3 — CID 40583570
2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(2S)-butan-2-yl]acetamide (PubChem CID 40583570) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(2S)-butan-2-yl]acetamide.
| Compound Name | 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(2S)-butan-2-yl]acetamide |
|---|---|
| PubChem CID | 40583570 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(2S)-butan-2-yl]acetamide |
| SMILES | CC[C@H](C)NC(=O)Cn1c(=O)c2c(ncn2C2CCCC2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C23H29N5O3/c1-3-16(2)25-19(29)14-27-22(30)20-21(24-15-28(20)18-11-7-8-12-18)26(23(27)31)13-17-9-5-4-6-10-17/h4-6,9-10,15-16,18H,3,7-8,11-14H2,1-2H3,(H,25,29)/t16-/m0/s1 |
| InChIKey | FOKSTOXJGZPPSA-INIZCTEOSA-N |
| XLogP | 2.44 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |