C24H25N5O4 — CID 3940386
2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 3940386) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3940386 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1c(=O)c2c(ncn2C2CCCC2)n(Cc2ccccc2)c1=O)NCc1ccco1 |
| InChI | InChI=1S/C24H25N5O4/c30-20(25-13-19-11-6-12-33-19)15-28-23(31)21-22(26-16-29(21)18-9-4-5-10-18)27(24(28)32)14-17-7-2-1-3-8-17/h1-3,6-8,11-12,16,18H,4-5,9-10,13-15H2,(H,25,30) |
| InChIKey | HFCSVQQPJRUYRI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |