C26H26ClN5O3 — CID 4012970
2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(4-chlorophenyl)methyl]acetamide (PubChem CID 4012970) has the molecular formula C26H26ClN5O3 and a molecular weight of 491.98 g/mol. Its IUPAC name is 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(4-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 4012970 |
| Molecular Formula | C26H26ClN5O3 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(4-chlorophenyl)methyl]acetamide |
| SMILES | O=C(Cn1c(=O)c2c(ncn2C2CCCC2)n(Cc2ccccc2)c1=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H26ClN5O3/c27-20-12-10-18(11-13-20)14-28-22(33)16-31-25(34)23-24(29-17-32(23)21-8-4-5-9-21)30(26(31)35)15-19-6-2-1-3-7-19/h1-3,6-7,10-13,17,21H,4-5,8-9,14-16H2,(H,28,33) |
| InChIKey | MJLAWBDJVCKYFX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |