C25H27N5O3S — CID 40966801
2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(1R)-1-thiophen-2-ylethyl]acetamide (PubChem CID 40966801) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(1R)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 40966801 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-(3-benzyl-7-cyclopentyl-2,6-dioxopurin-1-yl)-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cn1c(=O)c2c(ncn2C2CCCC2)n(Cc2ccccc2)c1=O)c1cccs1 |
| InChI | InChI=1S/C25H27N5O3S/c1-17(20-12-7-13-34-20)27-21(31)15-29-24(32)22-23(26-16-30(22)19-10-5-6-11-19)28(25(29)33)14-18-8-3-2-4-9-18/h2-4,7-9,12-13,16-17,19H,5-6,10-11,14-15H2,1H3,(H,27,31)/t17-/m1/s1 |
| InChIKey | KAXNUFJSFYDZHY-QGZVFWFLSA-N |
| XLogP | 3.46 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |