C26H26N8O — CID 68859550
8-(3-aminopiperidin-1-yl)-7-benzyl-1-(quinazolin-4-ylmethyl)purin-6-one (PubChem CID 68859550) has the molecular formula C26H26N8O and a molecular weight of 466.55 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-1-(quinazolin-4-ylmethyl)purin-6-one.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-(quinazolin-4-ylmethyl)purin-6-one |
|---|---|
| PubChem CID | 68859550 |
| Molecular Formula | C26H26N8O |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-(quinazolin-4-ylmethyl)purin-6-one |
| SMILES | NC1CCCN(c2nc3ncn(Cc4ncnc5ccccc45)c(=O)c3n2Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H26N8O/c27-19-9-6-12-32(14-19)26-31-24-23(34(26)13-18-7-2-1-3-8-18)25(35)33(17-30-24)15-22-20-10-4-5-11-21(20)28-16-29-22/h1-5,7-8,10-11,16-17,19H,6,9,12-15,27H2 |
| InChIKey | SRGFGVSVZBINKL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |