C24H27N5O3 — CID 68965850
6-(3-aminopiperidin-1-yl)-5-but-2-ynyl-3-[2-(3-methoxyphenyl)-2-oxoethyl]pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 68965850) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 6-(3-aminopiperidin-1-yl)-5-but-2-ynyl-3-[2-(3-methoxyphenyl)-2-oxoethyl]pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 6-(3-aminopiperidin-1-yl)-5-but-2-ynyl-3-[2-(3-methoxyphenyl)-2-oxoethyl]pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 68965850 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 6-(3-aminopiperidin-1-yl)-5-but-2-ynyl-3-[2-(3-methoxyphenyl)-2-oxoethyl]pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CC#CCn1c(N2CCCC(N)C2)cc2ncn(CC(=O)c3cccc(OC)c3)c(=O)c21 |
| InChI | InChI=1S/C24H27N5O3/c1-3-4-11-29-22(27-10-6-8-18(25)14-27)13-20-23(29)24(31)28(16-26-20)15-21(30)17-7-5-9-19(12-17)32-2/h5,7,9,12-13,16,18H,6,8,10-11,14-15,25H2,1-2H3 |
| InChIKey | QKIWCXQAQWBHFJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|