C23H26N5O3+ — CID 143491483
[2-(5-but-2-ynyl-4-oxo-6-piperazin-1-ylpyrrolo[3,2-d]pyrimidin-3-yl)-1-(3-methoxyphenyl)ethylidene]oxidanium (PubChem CID 143491483) has the molecular formula C23H26N5O3+ and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-(5-but-2-ynyl-4-oxo-6-piperazin-1-ylpyrrolo[3,2-d]pyrimidin-3-yl)-1-(3-methoxyphenyl)ethylidene]oxidanium.
| Compound Name | [2-(5-but-2-ynyl-4-oxo-6-piperazin-1-ylpyrrolo[3,2-d]pyrimidin-3-yl)-1-(3-methoxyphenyl)ethylidene]oxidanium |
|---|---|
| PubChem CID | 143491483 |
| Molecular Formula | C23H26N5O3+ |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [2-(5-but-2-ynyl-4-oxo-6-piperazin-1-ylpyrrolo[3,2-d]pyrimidin-3-yl)-1-(3-methoxyphenyl)ethylidene]oxidanium |
| SMILES | [H]/[O+]=C(/Cn1cnc2cc(N3CCNCC3)n(CC#CC)c2c1=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C23H25N5O3/c1-3-4-10-28-21(26-11-8-24-9-12-26)14-19-22(28)23(30)27(16-25-19)15-20(29)17-6-5-7-18(13-17)31-2/h5-7,13-14,16,24H,8-12,15H2,1-2H3/p+1 |
| InChIKey | IYZNQBPSVLOREL-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|