C18H21N7OS — CID 21054533
2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one (PubChem CID 21054533) has the molecular formula C18H21N7OS and a molecular weight of 383.48 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one.
| Compound Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 21054533 |
| Molecular Formula | C18H21N7OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2cnn(Cc3nccs3)c(=O)c21 |
| InChI | InChI=1S/C18H21N7OS/c1-2-3-8-24-16-14(22-18(24)23-7-4-5-13(19)11-23)10-21-25(17(16)26)12-15-20-6-9-27-15/h6,9-10,13H,4-5,7-8,11-12,19H2,1H3 |
| InChIKey | RHZHPEYLNDCDLQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|