C24H28N8O — CID 21054449
2-(3-aminopiperidin-1-yl)-3-(3-methylbut-2-enyl)-5-(quinazolin-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one (PubChem CID 21054449) has the molecular formula C24H28N8O and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-3-(3-methylbut-2-enyl)-5-(quinazolin-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one.
| Compound Name | 2-(3-aminopiperidin-1-yl)-3-(3-methylbut-2-enyl)-5-(quinazolin-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 21054449 |
| Molecular Formula | C24H28N8O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-3-(3-methylbut-2-enyl)-5-(quinazolin-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2cnn(Cc3ncc4ccccc4n3)c(=O)c21 |
| InChI | InChI=1S/C24H28N8O/c1-16(2)9-11-31-22-20(29-24(31)30-10-5-7-18(25)14-30)13-27-32(23(22)33)15-21-26-12-17-6-3-4-8-19(17)28-21/h3-4,6,8-9,12-13,18H,5,7,10-11,14-15,25H2,1-2H3 |
| InChIKey | BIKJSNKVNDFAGG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|