C27H31N7O — CID 21054441
2-(3-aminopiperidin-1-yl)-3-(cyclohexen-1-ylmethyl)-5-(isoquinolin-1-ylmethyl)imidazo[4,5-d]pyridazin-4-one (PubChem CID 21054441) has the molecular formula C27H31N7O and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-3-(cyclohexen-1-ylmethyl)-5-(isoquinolin-1-ylmethyl)imidazo[4,5-d]pyridazin-4-one.
| Compound Name | 2-(3-aminopiperidin-1-yl)-3-(cyclohexen-1-ylmethyl)-5-(isoquinolin-1-ylmethyl)imidazo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 21054441 |
| Molecular Formula | C27H31N7O |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-3-(cyclohexen-1-ylmethyl)-5-(isoquinolin-1-ylmethyl)imidazo[4,5-d]pyridazin-4-one |
| SMILES | NC1CCCN(c2nc3cnn(Cc4nccc5ccccc45)c(=O)c3n2CC2=CCCCC2)C1 |
| InChI | InChI=1S/C27H31N7O/c28-21-10-6-14-32(17-21)27-31-23-15-30-34(18-24-22-11-5-4-9-20(22)12-13-29-24)26(35)25(23)33(27)16-19-7-2-1-3-8-19/h4-5,7,9,11-13,15,21H,1-3,6,8,10,14,16-18,28H2 |
| InChIKey | BQPDOHDZVZBIFX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|