C21H27N7O — CID 21054417
2-(1,4-diazepan-1-yl)-3-(3-methylbut-2-enyl)-5-(pyridin-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one (PubChem CID 21054417) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-3-(3-methylbut-2-enyl)-5-(pyridin-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one.
| Compound Name | 2-(1,4-diazepan-1-yl)-3-(3-methylbut-2-enyl)-5-(pyridin-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 21054417 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-3-(3-methylbut-2-enyl)-5-(pyridin-2-ylmethyl)imidazo[4,5-d]pyridazin-4-one |
| SMILES | CC(C)=CCn1c(N2CCCNCC2)nc2cnn(Cc3ccccn3)c(=O)c21 |
| InChI | InChI=1S/C21H27N7O/c1-16(2)7-12-27-19-18(25-21(27)26-11-5-8-22-10-13-26)14-24-28(20(19)29)15-17-6-3-4-9-23-17/h3-4,6-7,9,14,22H,5,8,10-13,15H2,1-2H3 |
| InChIKey | UYEQNOMFPCTECE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|