C25H25FN6O — CID 21098096
3-but-2-ynyl-2-(1,4-diazepan-1-yl)-5-[(4-fluoronaphthalen-1-yl)methyl]imidazo[4,5-d]pyridazin-4-one (PubChem CID 21098096) has the molecular formula C25H25FN6O and a molecular weight of 444.51 g/mol. Its IUPAC name is 3-but-2-ynyl-2-(1,4-diazepan-1-yl)-5-[(4-fluoronaphthalen-1-yl)methyl]imidazo[4,5-d]pyridazin-4-one.
| Compound Name | 3-but-2-ynyl-2-(1,4-diazepan-1-yl)-5-[(4-fluoronaphthalen-1-yl)methyl]imidazo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 21098096 |
| Molecular Formula | C25H25FN6O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 3-but-2-ynyl-2-(1,4-diazepan-1-yl)-5-[(4-fluoronaphthalen-1-yl)methyl]imidazo[4,5-d]pyridazin-4-one |
| SMILES | CC#CCn1c(N2CCCNCC2)nc2cnn(Cc3ccc(F)c4ccccc34)c(=O)c21 |
| InChI | InChI=1S/C25H25FN6O/c1-2-3-14-31-23-22(29-25(31)30-13-6-11-27-12-15-30)16-28-32(24(23)33)17-18-9-10-21(26)20-8-5-4-7-19(18)20/h4-5,7-10,16,27H,6,11-15,17H2,1H3 |
| InChIKey | UPAYPXBPFQQOLJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|