C22H23N5O3 — CID 58638474
3-[(3-but-2-ynyl-4-oxo-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]benzoic acid (PubChem CID 58638474) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-[(3-but-2-ynyl-4-oxo-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]benzoic acid.
| Compound Name | 3-[(3-but-2-ynyl-4-oxo-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 58638474 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 3-[(3-but-2-ynyl-4-oxo-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]benzoic acid |
| SMILES | CC#CCn1c(N2CCCCC2)nc2cnn(Cc3cccc(C(=O)O)c3)c(=O)c21 |
| InChI | InChI=1S/C22H23N5O3/c1-2-3-12-26-19-18(24-22(26)25-10-5-4-6-11-25)14-23-27(20(19)28)15-16-8-7-9-17(13-16)21(29)30/h7-9,13-14H,4-6,10-12,15H2,1H3,(H,29,30) |
| InChIKey | CDPTWKFVTYWZTC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|