C24H24N6O2 — CID 58638278
3-but-2-ynyl-5-[(2-cyanophenyl)methyl]-4-oxo-2-piperidin-1-ylimidazo[4,5-c]pyridine-6-carboxamide (PubChem CID 58638278) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-but-2-ynyl-5-[(2-cyanophenyl)methyl]-4-oxo-2-piperidin-1-ylimidazo[4,5-c]pyridine-6-carboxamide.
| Compound Name | 3-but-2-ynyl-5-[(2-cyanophenyl)methyl]-4-oxo-2-piperidin-1-ylimidazo[4,5-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 58638278 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-but-2-ynyl-5-[(2-cyanophenyl)methyl]-4-oxo-2-piperidin-1-ylimidazo[4,5-c]pyridine-6-carboxamide |
| SMILES | CC#CCn1c(N2CCCCC2)nc2cc(C(N)=O)n(Cc3ccccc3C#N)c(=O)c21 |
| InChI | InChI=1S/C24H24N6O2/c1-2-3-13-29-21-19(27-24(29)28-11-7-4-8-12-28)14-20(22(26)31)30(23(21)32)16-18-10-6-5-9-17(18)15-25/h5-6,9-10,14H,4,7-8,11-13,16H2,1H3,(H2,26,31) |
| InChIKey | UVUWSWVQSIKABO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|