C28H26N8O3 — CID 58638252
3-[7-but-2-ynyl-1-[(2-isocyanophenyl)methyl]-6-oxo-8-piperidin-1-ylpurin-2-yl]oxypyridine-2-carboxamide (PubChem CID 58638252) has the molecular formula C28H26N8O3 and a molecular weight of 522.57 g/mol. Its IUPAC name is 3-[7-but-2-ynyl-1-[(2-isocyanophenyl)methyl]-6-oxo-8-piperidin-1-ylpurin-2-yl]oxypyridine-2-carboxamide.
| Compound Name | 3-[7-but-2-ynyl-1-[(2-isocyanophenyl)methyl]-6-oxo-8-piperidin-1-ylpurin-2-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 58638252 |
| Molecular Formula | C28H26N8O3 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 3-[7-but-2-ynyl-1-[(2-isocyanophenyl)methyl]-6-oxo-8-piperidin-1-ylpurin-2-yl]oxypyridine-2-carboxamide |
| SMILES | [C-]#[N+]c1ccccc1Cn1c(Oc2cccnc2C(N)=O)nc2nc(N3CCCCC3)n(CC#CC)c2c1=O |
| InChI | InChI=1S/C28H26N8O3/c1-3-4-17-35-23-25(32-27(35)34-15-8-5-9-16-34)33-28(39-21-13-10-14-31-22(21)24(29)37)36(26(23)38)18-19-11-6-7-12-20(19)30-2/h6-7,10-14H,5,8-9,15-18H2,1H3,(H2,29,37) |
| InChIKey | XRKPABLGUFLLFZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|