C22H22N6O2 — CID 58638396
2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)oxybenzonitrile (PubChem CID 58638396) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)oxybenzonitrile.
| Compound Name | 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 58638396 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)oxybenzonitrile |
| SMILES | CC#CCn1c(N2CCCCC2)nc2nc(Oc3ccccc3C#N)n(C)c(=O)c21 |
| InChI | InChI=1S/C22H22N6O2/c1-3-4-14-28-18-19(24-21(28)27-12-8-5-9-13-27)25-22(26(2)20(18)29)30-17-11-7-6-10-16(17)15-23/h6-7,10-11H,5,8-9,12-14H2,1-2H3 |
| InChIKey | WFVMXEPJYOMRDL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|