C25H26FN5O2 — CID 142948372
2-[(6-fluoro-7-morpholin-4-yl-4-oxo-2-piperidin-1-ylquinazolin-3-yl)methyl]benzonitrile (PubChem CID 142948372) has the molecular formula C25H26FN5O2 and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-[(6-fluoro-7-morpholin-4-yl-4-oxo-2-piperidin-1-ylquinazolin-3-yl)methyl]benzonitrile.
| Compound Name | 2-[(6-fluoro-7-morpholin-4-yl-4-oxo-2-piperidin-1-ylquinazolin-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 142948372 |
| Molecular Formula | C25H26FN5O2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-[(6-fluoro-7-morpholin-4-yl-4-oxo-2-piperidin-1-ylquinazolin-3-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1c(N2CCCCC2)nc2cc(N3CCOCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C25H26FN5O2/c26-21-14-20-22(15-23(21)29-10-12-33-13-11-29)28-25(30-8-4-1-5-9-30)31(24(20)32)17-19-7-3-2-6-18(19)16-27/h2-3,6-7,14-15H,1,4-5,8-13,17H2 |
| InChIKey | CMQLEKKDXYEXND-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |