C19H24F3N7O5 — CID 22029570
2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)propanamide;2,2,2-trifluoroacetic acid (PubChem CID 22029570) has the molecular formula C19H24F3N7O5 and a molecular weight of 487.44 g/mol. Its IUPAC name is 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029570 |
| Molecular Formula | C19H24F3N7O5 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)propanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2C(C)C(N)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N7O3.C2HF3O2/c1-4-5-8-23-12-14(20-16(23)22-9-6-19-7-10-22)24(11(2)13(18)25)17(27)21(3)15(12)26;3-2(4,5)1(6)7/h11,19H,6-10H2,1-3H3,(H2,18,25);(H,6,7) |
| InChIKey | GAKLWUNMKSITGO-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 157.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|