C17H26N6O4 — CID 70859885
ethyl 2-(7-ethyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxypropanoate (PubChem CID 70859885) has the molecular formula C17H26N6O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 2-(7-ethyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxypropanoate.
| Compound Name | ethyl 2-(7-ethyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxypropanoate |
|---|---|
| PubChem CID | 70859885 |
| Molecular Formula | C17H26N6O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | ethyl 2-(7-ethyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxypropanoate |
| SMILES | CCOC(=O)C(C)Oc1nc2nc(N3CCNCC3)n(CC)c2c(=O)n1C |
| InChI | InChI=1S/C17H26N6O4/c1-5-23-12-13(19-16(23)22-9-7-18-8-10-22)20-17(21(4)14(12)24)27-11(3)15(25)26-6-2/h11,18H,5-10H2,1-4H3 |
| InChIKey | XDVSGIKBCCHIIN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |