C23H29N7O3 — CID 70860026
7-ethyl-1-methyl-8-piperazin-1-yl-2-[2-(pyrrolidine-1-carbonyl)phenoxy]purin-6-one (PubChem CID 70860026) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 7-ethyl-1-methyl-8-piperazin-1-yl-2-[2-(pyrrolidine-1-carbonyl)phenoxy]purin-6-one.
| Compound Name | 7-ethyl-1-methyl-8-piperazin-1-yl-2-[2-(pyrrolidine-1-carbonyl)phenoxy]purin-6-one |
|---|---|
| PubChem CID | 70860026 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 7-ethyl-1-methyl-8-piperazin-1-yl-2-[2-(pyrrolidine-1-carbonyl)phenoxy]purin-6-one |
| SMILES | CCn1c(N2CCNCC2)nc2nc(Oc3ccccc3C(=O)N3CCCC3)n(C)c(=O)c21 |
| InChI | InChI=1S/C23H29N7O3/c1-3-30-18-19(25-22(30)29-14-10-24-11-15-29)26-23(27(2)21(18)32)33-17-9-5-4-8-16(17)20(31)28-12-6-7-13-28/h4-5,8-9,24H,3,6-7,10-15H2,1-2H3 |
| InChIKey | FVNCMFUXOWEATF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |