C19H22N6O4 — CID 22029727
methyl 2-(1,3-dimethyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)benzoate (PubChem CID 22029727) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl 2-(1,3-dimethyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)benzoate.
| Compound Name | methyl 2-(1,3-dimethyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)benzoate |
|---|---|
| PubChem CID | 22029727 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | methyl 2-(1,3-dimethyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)benzoate |
| SMILES | COC(=O)c1ccccc1-n1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H22N6O4/c1-22-15-14(16(26)23(2)19(22)28)25(18(21-15)24-10-8-20-9-11-24)13-7-5-4-6-12(13)17(27)29-3/h4-7,20H,8-11H2,1-3H3 |
| InChIKey | CGXILFAQIOISSN-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |