C18H20ClN7O3 — CID 22029432
2-[7-(2-chlorophenyl)-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]acetamide (PubChem CID 22029432) has the molecular formula C18H20ClN7O3 and a molecular weight of 417.86 g/mol. Its IUPAC name is 2-[7-(2-chlorophenyl)-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]acetamide.
| Compound Name | 2-[7-(2-chlorophenyl)-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]acetamide |
|---|---|
| PubChem CID | 22029432 |
| Molecular Formula | C18H20ClN7O3 |
| Molecular Weight | 417.86 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[7-(2-chlorophenyl)-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]acetamide |
| SMILES | Cn1c(=O)n(CC(N)=O)c(=O)c2c1nc(N1CCNCC1)n2-c1ccccc1Cl |
| InChI | InChI=1S/C18H20ClN7O3/c1-23-15-14(16(28)25(18(23)29)10-13(20)27)26(12-5-3-2-4-11(12)19)17(22-15)24-8-6-21-7-9-24/h2-5,21H,6-10H2,1H3,(H2,20,27) |
| InChIKey | CHAFNKFTCQWCAK-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.86 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |