C20H15Cl2N5O3 — CID 156714338
2-[8-(2-chlorophenyl)-7-(4-chlorophenyl)-3-methyl-2,6-dioxopurin-1-yl]acetamide (PubChem CID 156714338) has the molecular formula C20H15Cl2N5O3 and a molecular weight of 444.28 g/mol. Its IUPAC name is 2-[8-(2-chlorophenyl)-7-(4-chlorophenyl)-3-methyl-2,6-dioxopurin-1-yl]acetamide.
| Compound Name | 2-[8-(2-chlorophenyl)-7-(4-chlorophenyl)-3-methyl-2,6-dioxopurin-1-yl]acetamide |
|---|---|
| PubChem CID | 156714338 |
| Molecular Formula | C20H15Cl2N5O3 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-[8-(2-chlorophenyl)-7-(4-chlorophenyl)-3-methyl-2,6-dioxopurin-1-yl]acetamide |
| SMILES | Cn1c(=O)n(CC(N)=O)c(=O)c2c1nc(-c1ccccc1Cl)n2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2N5O3/c1-25-18-16(19(29)26(20(25)30)10-15(23)28)27(12-8-6-11(21)7-9-12)17(24-18)13-4-2-3-5-14(13)22/h2-9H,10H2,1H3,(H2,23,28) |
| InChIKey | YSTCIDIYNMIKPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |