C22H25N7O3S — CID 142878057
8-(2-aminoethylamino)-7-but-2-ynyl-1-methyl-2-[2-(1,3-thiazolidine-3-carbonyl)phenoxy]purin-6-one (PubChem CID 142878057) has the molecular formula C22H25N7O3S and a molecular weight of 467.56 g/mol. Its IUPAC name is 8-(2-aminoethylamino)-7-but-2-ynyl-1-methyl-2-[2-(1,3-thiazolidine-3-carbonyl)phenoxy]purin-6-one.
| Compound Name | 8-(2-aminoethylamino)-7-but-2-ynyl-1-methyl-2-[2-(1,3-thiazolidine-3-carbonyl)phenoxy]purin-6-one |
|---|---|
| PubChem CID | 142878057 |
| Molecular Formula | C22H25N7O3S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 8-(2-aminoethylamino)-7-but-2-ynyl-1-methyl-2-[2-(1,3-thiazolidine-3-carbonyl)phenoxy]purin-6-one |
| SMILES | CC#CCn1c(NCCN)nc2nc(Oc3ccccc3C(=O)N3CCSC3)n(C)c(=O)c21 |
| InChI | InChI=1S/C22H25N7O3S/c1-3-4-11-29-17-18(25-21(29)24-10-9-23)26-22(27(2)20(17)31)32-16-8-6-5-7-15(16)19(30)28-12-13-33-14-28/h5-8H,9-14,23H2,1-2H3,(H,24,25) |
| InChIKey | OVSZMTQWRPUUMF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|