C22H22F3N7O6S — CID 57472678
[[4-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxyphenyl]sulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 57472678) has the molecular formula C22H22F3N7O6S and a molecular weight of 569.52 g/mol. Its IUPAC name is [[4-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxyphenyl]sulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[4-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxyphenyl]sulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57472678 |
| Molecular Formula | C22H22F3N7O6S |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | [[4-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxyphenyl]sulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Oc3ccc(S(=O)(=O)NOC(=O)C(F)(F)F)cc3)n(C)c(=O)c21 |
| InChI | InChI=1S/C22H22F3N7O6S/c1-3-4-11-32-16-17(27-20(32)31-12-9-26-10-13-31)28-21(30(2)18(16)33)37-14-5-7-15(8-6-14)39(35,36)29-38-19(34)22(23,24)25/h5-8,26,29H,9-13H2,1-2H3 |
| InChIKey | KWJUBHXRDABHRM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|