C17H21ClN6O3 — CID 150830367
[1-(7-but-2-ynyl-2-chloro-1-methyl-6-oxopurin-8-yl)piperidin-3-yl]-methylcarbamic acid (PubChem CID 150830367) has the molecular formula C17H21ClN6O3 and a molecular weight of 392.85 g/mol. Its IUPAC name is [1-(7-but-2-ynyl-2-chloro-1-methyl-6-oxopurin-8-yl)piperidin-3-yl]-methylcarbamic acid.
| Compound Name | [1-(7-but-2-ynyl-2-chloro-1-methyl-6-oxopurin-8-yl)piperidin-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 150830367 |
| Molecular Formula | C17H21ClN6O3 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [1-(7-but-2-ynyl-2-chloro-1-methyl-6-oxopurin-8-yl)piperidin-3-yl]-methylcarbamic acid |
| SMILES | CC#CCn1c(N2CCCC(N(C)C(=O)O)C2)nc2nc(Cl)n(C)c(=O)c21 |
| InChI | InChI=1S/C17H21ClN6O3/c1-4-5-9-24-12-13(19-15(18)22(3)14(12)25)20-16(24)23-8-6-7-11(10-23)21(2)17(26)27/h11H,6-10H2,1-3H3,(H,26,27) |
| InChIKey | KLVOKZZDAVBNPR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|