C24H23N7O — CID 58638247
7-but-2-ynyl-2-isocyano-1-[(4-isocyanophenyl)methyl]-8-(3-methylpiperidin-1-yl)purin-6-one (PubChem CID 58638247) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is 7-but-2-ynyl-2-isocyano-1-[(4-isocyanophenyl)methyl]-8-(3-methylpiperidin-1-yl)purin-6-one.
| Compound Name | 7-but-2-ynyl-2-isocyano-1-[(4-isocyanophenyl)methyl]-8-(3-methylpiperidin-1-yl)purin-6-one |
|---|---|
| PubChem CID | 58638247 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 7-but-2-ynyl-2-isocyano-1-[(4-isocyanophenyl)methyl]-8-(3-methylpiperidin-1-yl)purin-6-one |
| SMILES | [C-]#[N+]c1ccc(Cn2c([N+]#[C-])nc3nc(N4CCCC(C)C4)n(CC#CC)c3c2=O)cc1 |
| InChI | InChI=1S/C24H23N7O/c1-5-6-14-30-20-21(28-24(30)29-13-7-8-17(2)15-29)27-23(26-4)31(22(20)32)16-18-9-11-19(25-3)12-10-18/h9-12,17H,7-8,13-16H2,1-2H3 |
| InChIKey | ARXTZQHKRBBRJP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|