C20H21N5 — CID 155619552
(3S)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]piperidin-3-amine (PubChem CID 155619552) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3S)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]piperidin-3-amine.
| Compound Name | (3S)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 155619552 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (3S)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CCC[C@H](N)C3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C20H21N5/c1-22-17-10-8-15(9-11-17)13-25-19-7-3-2-6-18(19)23-20(25)24-12-4-5-16(21)14-24/h2-3,6-11,16H,4-5,12-14,21H2/t16-/m0/s1 |
| InChIKey | LIVMIBCINDNUES-INIZCTEOSA-N |
| XLogP | 3.56 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|