C21H23N5 — CID 155619559
(3S,4R)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]-4-methylpiperidin-3-amine (PubChem CID 155619559) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is (3S,4R)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]-4-methylpiperidin-3-amine.
| Compound Name | (3S,4R)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]-4-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 155619559 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | (3S,4R)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]-4-methylpiperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CC[C@@H](C)[C@H](N)C3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C21H23N5/c1-15-11-12-25(14-18(15)22)21-24-19-5-3-4-6-20(19)26(21)13-16-7-9-17(23-2)10-8-16/h3-10,15,18H,11-14,22H2,1H3/t15-,18-/m1/s1 |
| InChIKey | JCWVMXZYTGUJBI-CRAIPNDOSA-N |
| XLogP | 3.81 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|