C20H18FN7 — CID 155619544
(3R,4R)-4-fluoro-1-[6-isocyano-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]piperidin-3-amine (PubChem CID 155619544) has the molecular formula C20H18FN7 and a molecular weight of 375.41 g/mol. Its IUPAC name is (3R,4R)-4-fluoro-1-[6-isocyano-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]piperidin-3-amine.
| Compound Name | (3R,4R)-4-fluoro-1-[6-isocyano-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 155619544 |
| Molecular Formula | C20H18FN7 |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (3R,4R)-4-fluoro-1-[6-isocyano-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CC[C@@H](F)[C@H](N)C3)nc3ccc([N+]#[C-])cc32)nc1 |
| InChI | InChI=1S/C20H18FN7/c1-23-13-5-6-18-19(9-13)28(11-15-4-3-14(24-2)10-25-15)20(26-18)27-8-7-16(21)17(22)12-27/h3-6,9-10,16-17H,7-8,11-12,22H2/t16-,17-/m1/s1 |
| InChIKey | ZIVRUFQJDODFBQ-IAGOWNOFSA-N |
| XLogP | 3.46 |
| TPSA | 68.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|