C19H20FN7 — CID 158151673
(4R)-4-fluoro-1-[5-isocyano-1-[(5-methylpyrimidin-2-yl)methyl]benzimidazol-2-yl]piperidin-3-amine (PubChem CID 158151673) has the molecular formula C19H20FN7 and a molecular weight of 365.42 g/mol. Its IUPAC name is (4R)-4-fluoro-1-[5-isocyano-1-[(5-methylpyrimidin-2-yl)methyl]benzimidazol-2-yl]piperidin-3-amine.
| Compound Name | (4R)-4-fluoro-1-[5-isocyano-1-[(5-methylpyrimidin-2-yl)methyl]benzimidazol-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 158151673 |
| Molecular Formula | C19H20FN7 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (4R)-4-fluoro-1-[5-isocyano-1-[(5-methylpyrimidin-2-yl)methyl]benzimidazol-2-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc2c(c1)nc(N1CC[C@@H](F)C(N)C1)n2Cc1ncc(C)cn1 |
| InChI | InChI=1S/C19H20FN7/c1-12-8-23-18(24-9-12)11-27-17-4-3-13(22-2)7-16(17)25-19(27)26-6-5-14(20)15(21)10-26/h3-4,7-9,14-15H,5-6,10-11,21H2,1H3/t14-,15?/m1/s1 |
| InChIKey | FVENPIOFFREVBK-GICMACPYSA-N |
| XLogP | 2.61 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|