C19H17Cl2FN6 — CID 155619704
(3R,4S)-1-[4,6-dichloro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-4-fluoropiperidin-3-amine (PubChem CID 155619704) has the molecular formula C19H17Cl2FN6 and a molecular weight of 419.29 g/mol. Its IUPAC name is (3R,4S)-1-[4,6-dichloro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-4-fluoropiperidin-3-amine.
| Compound Name | (3R,4S)-1-[4,6-dichloro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-4-fluoropiperidin-3-amine |
|---|---|
| PubChem CID | 155619704 |
| Molecular Formula | C19H17Cl2FN6 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (3R,4S)-1-[4,6-dichloro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-4-fluoropiperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CC[C@H](F)[C@H](N)C3)nc3c(Cl)cc(Cl)cc32)nc1 |
| InChI | InChI=1S/C19H17Cl2FN6/c1-24-12-2-3-13(25-8-12)9-28-17-7-11(20)6-14(21)18(17)26-19(28)27-5-4-15(22)16(23)10-27/h2-3,6-8,15-16H,4-5,9-10,23H2/t15-,16+/m0/s1 |
| InChIKey | LVPLEVOUEJLIFI-JKSUJKDBSA-N |
| XLogP | 4.21 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|