C19H16Cl2F2N6 — CID 155619645
(3R)-1-[4,6-dichloro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-4,4-difluoropiperidin-3-amine (PubChem CID 155619645) has the molecular formula C19H16Cl2F2N6 and a molecular weight of 437.28 g/mol. Its IUPAC name is (3R)-1-[4,6-dichloro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-4,4-difluoropiperidin-3-amine.
| Compound Name | (3R)-1-[4,6-dichloro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-4,4-difluoropiperidin-3-amine |
|---|---|
| PubChem CID | 155619645 |
| Molecular Formula | C19H16Cl2F2N6 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (3R)-1-[4,6-dichloro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-4,4-difluoropiperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CCC(F)(F)[C@H](N)C3)nc3c(Cl)cc(Cl)cc32)nc1 |
| InChI | InChI=1S/C19H16Cl2F2N6/c1-25-12-2-3-13(26-8-12)9-29-15-7-11(20)6-14(21)17(15)27-18(29)28-5-4-19(22,23)16(24)10-28/h2-3,6-8,16H,4-5,9-10,24H2/t16-/m1/s1 |
| InChIKey | KMKYKYGPNBPDAO-MRXNPFEDSA-N |
| XLogP | 4.51 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|