C20H20F2N6 — CID 159655334
(3R)-4,4-difluoro-1-[1-[(5-isocyano-2-pyridinyl)methyl]-5-methylbenzimidazol-2-yl]piperidin-3-amine (PubChem CID 159655334) has the molecular formula C20H20F2N6 and a molecular weight of 382.42 g/mol. Its IUPAC name is (3R)-4,4-difluoro-1-[1-[(5-isocyano-2-pyridinyl)methyl]-5-methylbenzimidazol-2-yl]piperidin-3-amine.
| Compound Name | (3R)-4,4-difluoro-1-[1-[(5-isocyano-2-pyridinyl)methyl]-5-methylbenzimidazol-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 159655334 |
| Molecular Formula | C20H20F2N6 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (3R)-4,4-difluoro-1-[1-[(5-isocyano-2-pyridinyl)methyl]-5-methylbenzimidazol-2-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CCC(F)(F)[C@H](N)C3)nc3cc(C)ccc32)nc1 |
| InChI | InChI=1S/C20H20F2N6/c1-13-3-6-17-16(9-13)26-19(27-8-7-20(21,22)18(23)12-27)28(17)11-15-5-4-14(24-2)10-25-15/h3-6,9-10,18H,7-8,11-12,23H2,1H3/t18-/m1/s1 |
| InChIKey | MSCGUVQLZGDEOA-GOSISDBHSA-N |
| XLogP | 3.51 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|