C20H21FN6O — CID 155619648
(3R,4S)-4-fluoro-1-[1-[(5-isocyano-2-pyridinyl)methyl]-5-methoxybenzimidazol-2-yl]piperidin-3-amine (PubChem CID 155619648) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is (3R,4S)-4-fluoro-1-[1-[(5-isocyano-2-pyridinyl)methyl]-5-methoxybenzimidazol-2-yl]piperidin-3-amine.
| Compound Name | (3R,4S)-4-fluoro-1-[1-[(5-isocyano-2-pyridinyl)methyl]-5-methoxybenzimidazol-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 155619648 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (3R,4S)-4-fluoro-1-[1-[(5-isocyano-2-pyridinyl)methyl]-5-methoxybenzimidazol-2-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CC[C@H](F)[C@H](N)C3)nc3cc(OC)ccc32)nc1 |
| InChI | InChI=1S/C20H21FN6O/c1-23-13-3-4-14(24-10-13)11-27-19-6-5-15(28-2)9-18(19)25-20(27)26-8-7-16(21)17(22)12-26/h3-6,9-10,16-17H,7-8,11-12,22H2,2H3/t16-,17+/m0/s1 |
| InChIKey | HIDALEUZCQKJEO-DLBZAZTESA-N |
| XLogP | 2.91 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|