C19H17F3N6 — CID 155619596
(3R)-4,4-difluoro-1-[5-fluoro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]piperidin-3-amine (PubChem CID 155619596) has the molecular formula C19H17F3N6 and a molecular weight of 386.38 g/mol. Its IUPAC name is (3R)-4,4-difluoro-1-[5-fluoro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]piperidin-3-amine.
| Compound Name | (3R)-4,4-difluoro-1-[5-fluoro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 155619596 |
| Molecular Formula | C19H17F3N6 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (3R)-4,4-difluoro-1-[5-fluoro-1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CCC(F)(F)[C@H](N)C3)nc3cc(F)ccc32)nc1 |
| InChI | InChI=1S/C19H17F3N6/c1-24-13-3-4-14(25-9-13)10-28-16-5-2-12(20)8-15(16)26-18(28)27-7-6-19(21,22)17(23)11-27/h2-5,8-9,17H,6-7,10-11,23H2/t17-/m1/s1 |
| InChIKey | QYWMYILYTXSRJA-QGZVFWFLSA-N |
| XLogP | 3.34 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|