C21H19FN6 — CID 155619739
(3R,4R)-4-fluoro-1-[5-isocyano-1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]piperidin-3-amine (PubChem CID 155619739) has the molecular formula C21H19FN6 and a molecular weight of 374.42 g/mol. Its IUPAC name is (3R,4R)-4-fluoro-1-[5-isocyano-1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]piperidin-3-amine.
| Compound Name | (3R,4R)-4-fluoro-1-[5-isocyano-1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 155619739 |
| Molecular Formula | C21H19FN6 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (3R,4R)-4-fluoro-1-[5-isocyano-1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3CC[C@@H](F)[C@H](N)C3)nc3cc([N+]#[C-])ccc32)cc1 |
| InChI | InChI=1S/C21H19FN6/c1-24-15-5-3-14(4-6-15)12-28-20-8-7-16(25-2)11-19(20)26-21(28)27-10-9-17(22)18(23)13-27/h3-8,11,17-18H,9-10,12-13,23H2/t17-,18-/m1/s1 |
| InChIKey | JSSVKGUQAWJUDV-QZTJIDSGSA-N |
| XLogP | 4.06 |
| TPSA | 55.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|