C23H24F3N5O2 — CID 158879807
(3S,4R)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]-4-methylpiperidin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 158879807) has the molecular formula C23H24F3N5O2 and a molecular weight of 459.47 g/mol. Its IUPAC name is (3S,4R)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]-4-methylpiperidin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,4R)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]-4-methylpiperidin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158879807 |
| Molecular Formula | C23H24F3N5O2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (3S,4R)-1-[1-[(4-isocyanophenyl)methyl]benzimidazol-2-yl]-4-methylpiperidin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[C-]#[N+]c1ccc(Cn2c(N3CC[C@@H](C)[C@H](N)C3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C21H23N5.C2HF3O2/c1-15-11-12-25(14-18(15)22)21-24-19-5-3-4-6-20(19)26(21)13-16-7-9-17(23-2)10-8-16;3-2(4,5)1(6)7/h3-10,15,18H,11-14,22H2,1H3;(H,6,7)/t15-,18-;/m1./s1 |
| InChIKey | VTVQGYXADOZPFV-KQKCUOLZSA-N |
| XLogP | 4.44 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|