C18H16F3N7 — CID 155619577
(3R,4R)-1-[4,6-difluoro-1-[(5-isocyanopyrazin-2-yl)methyl]benzimidazol-2-yl]-4-fluoropiperidin-3-amine (PubChem CID 155619577) has the molecular formula C18H16F3N7 and a molecular weight of 387.37 g/mol. Its IUPAC name is (3R,4R)-1-[4,6-difluoro-1-[(5-isocyanopyrazin-2-yl)methyl]benzimidazol-2-yl]-4-fluoropiperidin-3-amine.
| Compound Name | (3R,4R)-1-[4,6-difluoro-1-[(5-isocyanopyrazin-2-yl)methyl]benzimidazol-2-yl]-4-fluoropiperidin-3-amine |
|---|---|
| PubChem CID | 155619577 |
| Molecular Formula | C18H16F3N7 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (3R,4R)-1-[4,6-difluoro-1-[(5-isocyanopyrazin-2-yl)methyl]benzimidazol-2-yl]-4-fluoropiperidin-3-amine |
| SMILES | [C-]#[N+]c1cnc(Cn2c(N3CC[C@@H](F)[C@H](N)C3)nc3c(F)cc(F)cc32)cn1 |
| InChI | InChI=1S/C18H16F3N7/c1-23-16-7-24-11(6-25-16)8-28-15-5-10(19)4-13(21)17(15)26-18(28)27-3-2-12(20)14(22)9-27/h4-7,12,14H,2-3,8-9,22H2/t12-,14-/m1/s1 |
| InChIKey | HLCIGYWDGKMGSQ-TZMCWYRMSA-N |
| XLogP | 2.58 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|